Products 1064137-50-3
CAS 1064137-50-3 is the registry number for 2,5-Dichloroquinoline-3-carbaldehyde, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,5-dichloroquinoline-3-carbaldehyde (CAS 1064137-50-3) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 2,5-dichloroquinoline-3-carbaldehyde. InChIKey: RDFSHUOAFWULQT-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 2,5-dichloroquinoline-3-carbaldehyde |
| InChIKey | RDFSHUOAFWULQT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C(=N2)Cl)C=O)C(=C1)Cl |
Computed by PubChem (NCBI)