Products 83823-56-7
CAS 83823-56-7 is the registry number for 6,8-Dichloro-2H-chromene-3-carbonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6,8-dichloro-2H-chromene-3-carbonitrile (CAS 83823-56-7) is a chemical compound with the molecular formula C10H5Cl2NO and a molecular weight of 226.06 g/mol. IUPAC name: 6,8-dichloro-2H-chromene-3-carbonitrile. InChIKey: BDPSIHZVSJWBBD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl2NO |
|---|---|
| Molecular weight | 226.06 g/mol |
| IUPAC name | 6,8-dichloro-2H-chromene-3-carbonitrile |
| InChIKey | BDPSIHZVSJWBBD-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C(=CC(=C2)Cl)Cl)C#N |
Computed by PubChem (NCBI)