cas: 1373693-69-6 — see every product listed under this CAS number, including other names
2,6-Dimethoxy-3-(trimethylsilyl)pyridine, 97% (CAS 1373693-69-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A145933-10g |
| cas | 1373693-69-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 12933.76 Pln | |
| AmBeed | 25g | 25374.37 Pln | |
| AmBeed | 5g | 7602.07 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2,6-dimethoxy-3-pyridinyl)-trimethylsilane (CAS 1373693-69-6) is a chemical compound with the molecular formula C10H17NO2Si and a molecular weight of 211.33 g/mol. IUPAC name: (2,6-dimethoxy-3-pyridinyl)-trimethylsilane. InChIKey: QSIPIDWHOPSOKZ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2Si |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (2,6-dimethoxy-3-pyridinyl)-trimethylsilane |
| InChIKey | QSIPIDWHOPSOKZ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[Si](C)(C)C)OC |
Computed by PubChem (NCBI)