cas: 1373693-69-6 — see every product listed under this CAS number, including other names
2,6-dimethoxy-3-(trimethylsilyl)pyridine, ≥95%, ≥95% (CAS 1373693-69-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch132QE8-1g |
| cas | 1373693-69-6 |
| size | 1g |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1154.00 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2,6-dimethoxy-3-pyridinyl)-trimethylsilane (CAS 1373693-69-6) is a chemical compound with the molecular formula C10H17NO2Si and a molecular weight of 211.33 g/mol. IUPAC name: (2,6-dimethoxy-3-pyridinyl)-trimethylsilane. InChIKey: QSIPIDWHOPSOKZ-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2Si |
|---|---|
| Molecular weight | 211.33 g/mol |
| IUPAC name | (2,6-dimethoxy-3-pyridinyl)-trimethylsilane |
| InChIKey | QSIPIDWHOPSOKZ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[Si](C)(C)C)OC |
Computed by PubChem (NCBI)