cas: 2121512-34-1 — see every product listed under this CAS number, including other names
2,6-Dimethoxy-3-methylsulfanylpyridine-5-boronic acid (CAS 2121512-34-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627624-500MG |
| cas | 2121512-34-1 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 7797.27 Pln |
| delivery time | 3-4 weeks |
|---|
(2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid (CAS 2121512-34-1) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: (2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid. InChIKey: MCVDHIUFVLLBCV-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | (2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid |
| InChIKey | MCVDHIUFVLLBCV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1OC)OC)SC)(O)O |
Computed by PubChem (NCBI)