CAS 871329-65-6 appears in our catalog under these names: N-Ethyl 4-boronobenzenesulfonamide, 98%, (4-(N-Ethylsulfamoyl)phenyl)boronic acid, 95-<97%, (4-(N-Ethylsulfamoyl)phenyl)boronic acid, 95%, 95%, (4-(N-Ethylsulfamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 50g, 100g.
[4-(ethylsulfamoyl)phenyl]boronic acid (CAS 871329-65-6) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [4-(ethylsulfamoyl)phenyl]boronic acid. InChIKey: YVKVLCDUDPTJEW-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [4-(ethylsulfamoyl)phenyl]boronic acid |
| InChIKey | YVKVLCDUDPTJEW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCC)(O)O |
Computed by PubChem (NCBI)