Products 2121512-34-1

CAS 2121512-34-1 appears in our catalog under these names: 2,6-Dimethoxy-3-methylsulfanylpyridine-5-boronic acid, 95%, 2,6-Dimethoxy-3-methylsulfanylpyridine-5-boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g, 500mg.

Structural formula: {0} (CAS {1})

(2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid (CAS 2121512-34-1) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: (2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid. InChIKey: MCVDHIUFVLLBCV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H12BNO4S
Molecular weight229.07 g/mol
IUPAC name(2,6-dimethoxy-5-methylsulfanyl-3-pyridinyl)boronic acid
InChIKeyMCVDHIUFVLLBCV-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1OC)OC)SC)(O)O

Computed by PubChem (NCBI)