cas: 18677-41-3 — see every product listed under this CAS number, including other names
2,6-Dimethoxy-3-nitropyridine (CAS 18677-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222608-100MG |
| cas | 18677-41-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 888.25 Pln | |
| Fluorochem | 25g | 4001.73 Pln |
| delivery time | 3-4 weeks |
|---|
2,6-dimethoxy-3-nitropyridine (CAS 18677-41-3) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2,6-dimethoxy-3-nitropyridine. InChIKey: HZVWNFPJKCNELX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2,6-dimethoxy-3-nitropyridine |
| InChIKey | HZVWNFPJKCNELX-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)