CAS 18677-41-3 appears in our catalog under these names: 2,6-Dimethoxy-3-nitropyridine, 97%, 2,6-Dimethoxy-3-nitropyridine 97%, 2,6-Dimethoxy-3-nitropyridine, 97%, 97%, 2,6-Dimethoxy-3-nitropyridine, 97%(GC-MS),RG. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg.
2,6-dimethoxy-3-nitropyridine (CAS 18677-41-3) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2,6-dimethoxy-3-nitropyridine. InChIKey: HZVWNFPJKCNELX-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2,6-dimethoxy-3-nitropyridine |
| InChIKey | HZVWNFPJKCNELX-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)