CAS 79491-44-4 is the registry number for 2,3-Dimethoxy-6-nitropyridine, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,3-dimethoxy-6-nitropyridine (CAS 79491-44-4) is a chemical compound with the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. IUPAC name: 2,3-dimethoxy-6-nitropyridine. InChIKey: QDBVUQQJSXYDHF-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O4 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2,3-dimethoxy-6-nitropyridine |
| InChIKey | QDBVUQQJSXYDHF-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C=C1)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)