Products 145980-89-8

CAS 145980-89-8 appears in our catalog under these names: 2,6-Dimethoxybenzene-1-sulfonyl chloride, 2,6-Dimethoxybenzenesulfonyl Chloride, 95%, 95%, 2,6-Dimethoxybenzenesulfonyl chloride, 96%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100g, 250mg, 1g, 25g.

Structural formula: {0} (CAS {1})

2,6-dimethoxybenzenesulfonyl chloride (CAS 145980-89-8) is a chemical compound with the molecular formula C8H9ClO4S and a molecular weight of 236.67 g/mol. IUPAC name: 2,6-dimethoxybenzenesulfonyl chloride. InChIKey: KLVZDQNSNTUNGU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO4S
Molecular weight236.67 g/mol
IUPAC name2,6-dimethoxybenzenesulfonyl chloride
InChIKeyKLVZDQNSNTUNGU-UHFFFAOYSA-N
SMILESCOC1=C(C(=CC=C1)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)