cas: 260447-04-9 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-(5-nitropyridin-2-yl)morpholine 96% (CAS 260447-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A429794-250mg |
| cas | 260447-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 826.50 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A429794 |
2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine (CAS 260447-04-9) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: 2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine. InChIKey: OEWWQMFPALMWEF-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2,6-dimethyl-4-(5-nitro-2-pyridinyl)morpholine |
| InChIKey | OEWWQMFPALMWEF-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)