CAS 2381-07-9 appears in our catalog under these names: Ac-tyr-nhnh2, 98%, Ac-Tyr-NHNH2, (S)-N-(1-Hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl)acetamide, 97%, AC-TYR-NHNH2, ≥98%, ≥98%. Offered by: Combi-blocks, Creative Peptides, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
N-[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]acetamide (CAS 2381-07-9) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: N-[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]acetamide. InChIKey: CRZZRSWETKBGET-JTQLQIEISA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | N-[(2S)-1-hydrazinyl-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]acetamide |
| InChIKey | CRZZRSWETKBGET-JTQLQIEISA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NN |
Computed by PubChem (NCBI)