Products 1365988-19-7
CAS 1365988-19-7 appears in our catalog under these names: 1-(1-Acetylpiperidin-4-yl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(1-Acetylpiperidin-4-yl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(1-acetylpiperidin-4-yl)pyrazole-4-carboxylic acid (CAS 1365988-19-7) is a chemical compound with the molecular formula C11H15N3O3 and a molecular weight of 237.25 g/mol. IUPAC name: 1-(1-acetylpiperidin-4-yl)pyrazole-4-carboxylic acid. InChIKey: HRXIZPQWAMIIPU-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O3 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 1-(1-acetylpiperidin-4-yl)pyrazole-4-carboxylic acid |
| InChIKey | HRXIZPQWAMIIPU-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(CC1)N2C=C(C=N2)C(=O)O |
Computed by PubChem (NCBI)