cas: 1171028-56-0 — see every product listed under this CAS number, including other names
2,6-Dimethyl-4-(pyridin-4-yl)morpholine hydrochloride, 98% (CAS 1171028-56-0) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1107400-10g |
| cas | 1171028-56-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16065.07 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride (CAS 1171028-56-0) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: 2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride. InChIKey: XVWNTLZQVWXJOE-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | 2,6-dimethyl-4-pyridin-4-ylmorpholine;hydrochloride |
| InChIKey | XVWNTLZQVWXJOE-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=CC=NC=C2.Cl |
Computed by PubChem (NCBI)