cas: 304-28-9 — see every product listed under this CAS number, including other names
2,7-Di(acetamido)fluorene, 99%, 99% (CAS 304-28-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114114-200mg |
| cas | 304-28-9 |
| size | 200mg |
| availability | 0.8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 170.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-(7-acetamido-9H-fluoren-2-yl)acetamide (CAS 304-28-9) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: N-(7-acetamido-9H-fluoren-2-yl)acetamide. InChIKey: XBZBRCVCSVLJJZ-UHFFFAOYSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | N-(7-acetamido-9H-fluoren-2-yl)acetamide |
| InChIKey | XBZBRCVCSVLJJZ-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)C3=C(C2)C=C(C=C3)NC(=O)C |
Computed by PubChem (NCBI)