CAS 736949-02-3 appears in our catalog under these names: (2E)-2-Cyano-3-[2,5-dimethyl-1-(3-methylphenyl)-1h-pyrrol-3-yl]acrylic acid, 95%, 2-Cyano-3-(2,5-dimethyl-1-(3-methylphenyl)-1H-pyrrol-3-yl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
(E)-2-cyano-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enoic acid (CAS 736949-02-3) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enoic acid. InChIKey: PYJLFGHDGOXLJV-OQLLNIDSSA-N.
| Molecular formula | C17H16N2O2 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (E)-2-cyano-3-[2,5-dimethyl-1-(3-methylphenyl)pyrrol-3-yl]prop-2-enoic acid |
| InChIKey | PYJLFGHDGOXLJV-OQLLNIDSSA-N |
| SMILES | CC1=CC(=CC=C1)N2C(=CC(=C2C)/C=C(\C#N)/C(=O)O)C |
Computed by PubChem (NCBI)