cas: 132717-37-4 — see every product listed under this CAS number, including other names
2,7-Dibromo-9-phenyl-9H-fluoren-9-ol, 95%, 95% (CAS 132717-37-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11222G-1g |
| cas | 132717-37-4 |
| size | 1g |
| availability | 64.749g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 318.80 Pln | |
| Chemat | 10g | 491.60 Pln | |
| Chemat | 25g | 894.80 Pln | |
| Chemat | 50g | 1490.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,7-dibromo-9-phenylfluoren-9-ol (CAS 132717-37-4) is a chemical compound with the molecular formula C19H12Br2O and a molecular weight of 416.1 g/mol. IUPAC name: 2,7-dibromo-9-phenylfluoren-9-ol. InChIKey: VGZUBRZNTWOSTO-UHFFFAOYSA-N.
| Molecular formula | C19H12Br2O |
|---|---|
| Molecular weight | 416.1 g/mol |
| IUPAC name | 2,7-dibromo-9-phenylfluoren-9-ol |
| InChIKey | VGZUBRZNTWOSTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Br)C4=C2C=C(C=C4)Br)O |
Computed by PubChem (NCBI)