2,7-Dichlorobenzo[d]thiazole, 95%
cas: 2942-23-6 — see every product listed under this CAS number, including other names
2,7-Dichlorobenzo[d]thiazole, 95% (CAS 2942-23-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A114268-250mg |
| cas | 2942-23-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 894.80 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 314.36 Pln | |
| BLDpharm | 5g | 1180.72 Pln | |
| Fluorochem | 100mg | 102.06 Pln | |
| Fluorochem | 250mg | 117.68 Pln | |
| Fluorochem | 1g | 305.12 Pln | |
| Fluorochem | 5g | 1138.16 Pln | |
| Fluorochem | 10g | 2184.66 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2,7-dichloro-1,3-benzothiazole (CAS 2942-23-6) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 2,7-dichloro-1,3-benzothiazole. InChIKey: MBKFIAXHERNXNL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 2,7-dichloro-1,3-benzothiazole |
| InChIKey | MBKFIAXHERNXNL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)SC(=N2)Cl |
Computed by PubChem (NCBI)