CAS 1695203-36-1 is the registry number for 6,7-Dichlorobenzo[d]thiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-1,3-benzothiazole (CAS 1695203-36-1) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 6,7-dichloro-1,3-benzothiazole. InChIKey: GXJZHNRPPJSUNL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 6,7-dichloro-1,3-benzothiazole |
| InChIKey | GXJZHNRPPJSUNL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=CS2)Cl)Cl |
Computed by PubChem (NCBI)