CAS 3622-30-8 appears in our catalog under these names: 2,4–Dichlorobenzothiazole, 2,4-Dichlorobenzothiazole 95%, 2,4-Dichlorobenzothiazole, 95%, 95%, 2,4-Dichlorobenzothiazole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
2,4-dichloro-1,3-benzothiazole (CAS 3622-30-8) is a chemical compound with the molecular formula C7H3Cl2NS and a molecular weight of 204.08 g/mol. IUPAC name: 2,4-dichloro-1,3-benzothiazole. InChIKey: JJWANONAOYNRME-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2NS |
|---|---|
| Molecular weight | 204.08 g/mol |
| IUPAC name | 2,4-dichloro-1,3-benzothiazole |
| InChIKey | JJWANONAOYNRME-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(S2)Cl |
Computed by PubChem (NCBI)