cas: 820245-84-9 — see every product listed under this CAS number, including other names
2,7-Dimethylimidazo[1,2-a]pyridine-3-carbaldehyde, ≥96%, ≥96% (CAS 820245-84-9) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 50mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11649D-10mg |
| cas | 820245-84-9 |
| size | 10mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 218.00 Pln | |
| Chemat | 50mg | 611.60 Pln | |
| Chemat | 250mg | 2008.40 Pln |
| purity | ≥96% |
|---|---|
| delivery time | 3 weeks |
2,7-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde (CAS 820245-84-9) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 2,7-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde. InChIKey: RODAAWLSKNVZGK-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 2,7-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde |
| InChIKey | RODAAWLSKNVZGK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=C(N2C=C1)C=O)C |
Computed by PubChem (NCBI)