CAS 22098-62-0 appears in our catalog under these names: 1H-Imidazol-2-yl(phenyl)methanol, 95%, 1H-Imidazol-2-yl(phenyl)methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g.
1H-imidazol-2-yl(phenyl)methanol (CAS 22098-62-0) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 1H-imidazol-2-yl(phenyl)methanol. InChIKey: APKDHLMIBHYURQ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 1H-imidazol-2-yl(phenyl)methanol |
| InChIKey | APKDHLMIBHYURQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=NC=CN2)O |
Computed by PubChem (NCBI)