CAS 89260-50-4 appears in our catalog under these names: 4-(2-Methyloxazol-5-yl)aniline, 97%, 4-(2-Methyl-1,3-oxazol-5-yl)aniline, 95%, (4-(2-Methyl-1,3-oxazol-5-yl)phenyl)amine. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 500mg, 1000mg, 2000mg.
4-(2-methyl-1,3-oxazol-5-yl)aniline (CAS 89260-50-4) is a chemical compound with the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. IUPAC name: 4-(2-methyl-1,3-oxazol-5-yl)aniline. InChIKey: AZABYWRROKMRRC-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O |
|---|---|
| Molecular weight | 174.20 g/mol |
| IUPAC name | 4-(2-methyl-1,3-oxazol-5-yl)aniline |
| InChIKey | AZABYWRROKMRRC-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(O1)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)