2,9-Dibromo-1,10-phenanthroline, 98%
cas: 39069-02-8 — see every product listed under this CAS number, including other names
2,9-Dibromo-1,10-phenanthroline, 98% (CAS 39069-02-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G8D-100mg |
| cas | 39069-02-8 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 717.20 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 5022.80 Pln | |
| Chemat | 250g | 5589.20 Pln | |
| Chemat | 500g | 10459.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,9-dibromo-1,10-phenanthroline (CAS 39069-02-8) is a chemical compound with the molecular formula C12H6Br2N2 and a molecular weight of 338.00 g/mol. IUPAC name: 2,9-dibromo-1,10-phenanthroline. InChIKey: QNLGXYVSHITTGT-UHFFFAOYSA-N.
| Molecular formula | C12H6Br2N2 |
|---|---|
| Molecular weight | 338.00 g/mol |
| IUPAC name | 2,9-dibromo-1,10-phenanthroline |
| InChIKey | QNLGXYVSHITTGT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)Br)N=C(C=C2)Br |
Computed by PubChem (NCBI)