cas: 980-26-7 — see every product listed under this CAS number, including other names
2,9-Dimethylquinolino[2,3-b]acridine-7,14(5H,12H)-dione, Tinting strength >99%, Tinting strength >99% (CAS 980-26-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 75g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK1D-1g |
| cas | 980-26-7 |
| size | 1g |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 102.80 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 50g | 165.20 Pln | |
| Chemat | 75g | 213.20 Pln | |
| Chemat | 100g | 227.60 Pln | |
| Chemat | 250g | 438.80 Pln |
| purity | Tinting strength >99% |
|---|---|
| delivery time | 3 weeks |
2,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione (CAS 980-26-7) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 2,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione. InChIKey: TXWSZJSDZKWQAU-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2,9-dimethyl-5,12-dihydroquinolino[2,3-b]acridine-7,14-dione |
| InChIKey | TXWSZJSDZKWQAU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=CC4=C(C=C3C2=O)NC5=C(C4=O)C=C(C=C5)C |
Computed by PubChem (NCBI)