CAS 5496-35-5 appears in our catalog under these names: 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic acid, 97%, I-XW-053, I–XW–053, 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic Acid, >98.0%(HPLC)(T), 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic Acid 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 25g, 5g, 500mg, 50g, 250mg, 10g, 100g.
4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid (CAS 5496-35-5) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid. InChIKey: BCXPNUSETAZHEQ-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid |
| InChIKey | BCXPNUSETAZHEQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(N2)C3=CC=C(C=C3)C(=O)O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)