CAS 1375084-46-0 appears in our catalog under these names: (9H-Fluoren-9-yl)methyl (4-cyanophenyl)carbamate, 95-<97%, (9H-Fluoren-9-yl)methyl (4-cyanophenyl)carbamate, 98%, 98%, (9H-Fluoren-9-yl)methyl (4-cyanophenyl)carbamate, 98%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 50g, 100g, 100mg, 250mg, 1g.
9H-fluoren-9-ylmethyl N-(4-cyanophenyl)carbamate (CAS 1375084-46-0) is a chemical compound with the molecular formula C22H16N2O2 and a molecular weight of 340.4 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(4-cyanophenyl)carbamate. InChIKey: GGFSOILXTNKWET-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O2 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(4-cyanophenyl)carbamate |
| InChIKey | GGFSOILXTNKWET-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)