cas: 1523618-22-5 — see every product listed under this CAS number, including other names
2–(3–aminooxetan–3–yl)ethan–1–ol hemioxalate (CAS 1523618-22-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 500mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD01285-100mg |
| cas | 1523618-22-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 1130.62 Pln | |
| GLPBio | 1g | 3957.64 Pln | |
| GLPBio | 250mg | 1930.98 Pln | |
| GLPBio | 500mg | 3016.86 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
Bis(2-(3-aminooxetan-3-yl)ethanol);oxalic acid (CAS 1523618-22-5) is a chemical compound with the molecular formula C12H24N2O8 and a molecular weight of 324.33 g/mol. IUPAC name: bis(2-(3-aminooxetan-3-yl)ethanol);oxalic acid. InChIKey: BLHWKHZGQDLSFG-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O8 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | bis(2-(3-aminooxetan-3-yl)ethanol);oxalic acid |
| InChIKey | BLHWKHZGQDLSFG-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(CCO)N.C1C(CO1)(CCO)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)