CAS 1523571-98-3 appears in our catalog under these names: 3-Aminomethyl-3-(hydroxymethyl)oxetane hemioxalate, 95%, (3-(Aminomethyl)oxetan-3-yl)methanol oxalate(2:1), 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 25g.
Bis([3-(aminomethyl)oxetan-3-yl]methanol);oxalic acid (CAS 1523571-98-3) is a chemical compound with the molecular formula C12H24N2O8 and a molecular weight of 324.33 g/mol. IUPAC name: bis([3-(aminomethyl)oxetan-3-yl]methanol);oxalic acid. InChIKey: OJASASOKZSYAGK-UHFFFAOYSA-N.
| Molecular formula | C12H24N2O8 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | bis([3-(aminomethyl)oxetan-3-yl]methanol);oxalic acid |
| InChIKey | OJASASOKZSYAGK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(CN)CO.C1C(CO1)(CN)CO.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)