CAS 94071-01-9 is the registry number for N6-D-gluconoyl-L-lysine. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-6-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]hexanoic acid (CAS 94071-01-9) is a chemical compound with the molecular formula C12H24N2O8 and a molecular weight of 324.33 g/mol. IUPAC name: (2S)-2-amino-6-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]hexanoic acid. InChIKey: FBVIZNUUKKOZQB-LOLPMWEVSA-N.
| Molecular formula | C12H24N2O8 |
|---|---|
| Molecular weight | 324.33 g/mol |
| IUPAC name | (2S)-2-amino-6-[[(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoyl]amino]hexanoic acid |
| InChIKey | FBVIZNUUKKOZQB-LOLPMWEVSA-N |
| SMILES | C(CCNC(=O)[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)