CAS 15206-27-6 is the registry number for 2-Chloro-6-nitropyridin-3-ol, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-chloro-6-nitropyridin-3-ol (CAS 15206-27-6) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 2-chloro-6-nitropyridin-3-ol. InChIKey: JLOOSCMRJTYVNT-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 2-chloro-6-nitropyridin-3-ol |
| InChIKey | JLOOSCMRJTYVNT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)