CAS 150718-29-9 appears in our catalog under these names: 5-Chloro-3-oxo-3,4-dihydropyrazine-2-carboxylic acid, 95%, 5-Chloro-3-hydroxypyrazine-2-carboxylic acid, 97%, 5–Chloro–3–oxo–3,4–dihydropyrazine–2–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-chloro-2-oxo-1H-pyrazine-3-carboxylic acid (CAS 150718-29-9) is a chemical compound with the molecular formula C5H3ClN2O3 and a molecular weight of 174.54 g/mol. IUPAC name: 6-chloro-2-oxo-1H-pyrazine-3-carboxylic acid. InChIKey: AVFMENMETODLQX-UHFFFAOYSA-N.
| Molecular formula | C5H3ClN2O3 |
|---|---|
| Molecular weight | 174.54 g/mol |
| IUPAC name | 6-chloro-2-oxo-1H-pyrazine-3-carboxylic acid |
| InChIKey | AVFMENMETODLQX-UHFFFAOYSA-N |
| SMILES | C1=C(NC(=O)C(=N1)C(=O)O)Cl |
Computed by PubChem (NCBI)