cas: 53297-68-0 — see every product listed under this CAS number, including other names
2–Chloro–4–sulfamoylaniline (CAS 53297-68-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF36384-10g |
| cas | 53297-68-0 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 6714.45 Pln | |
| GLPBio | 1g | 1729.72 Pln | |
| GLPBio | 250mg | 994.88 Pln | |
| GLPBio | 5g | 4238.47 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-amino-3-chlorobenzenesulfonamide (CAS 53297-68-0) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 4-amino-3-chlorobenzenesulfonamide. InChIKey: LFIOFZKZCDMGFG-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-amino-3-chlorobenzenesulfonamide |
| InChIKey | LFIOFZKZCDMGFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)N |
Computed by PubChem (NCBI)