cas: 53297-68-0 — see every product listed under this CAS number, including other names
2-Chloro-4-sulfamoylaniline, 98% (CAS 53297-68-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F433389-250MG |
| cas | 53297-68-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 81.24 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 2.5g | 169.75 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 346.77 Pln | |
| Fluorochem | 25g | 685.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-amino-3-chlorobenzenesulfonamide (CAS 53297-68-0) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 4-amino-3-chlorobenzenesulfonamide. InChIKey: LFIOFZKZCDMGFG-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 4-amino-3-chlorobenzenesulfonamide |
| InChIKey | LFIOFZKZCDMGFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)Cl)N |
Computed by PubChem (NCBI)