cas: 220227-59-8 — see every product listed under this CAS number, including other names
2–Fluoro–5–(trifluoromethyl)phenylacetonitrile (CAS 220227-59-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13622-10g |
| cas | 220227-59-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1088.49 Pln | |
| GLPBio | 1g | 522.15 Pln | |
| GLPBio | 25g | 1884.18 Pln | |
| GLPBio | 5g | 821.70 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-fluoro-5-(trifluoromethyl)phenyl]acetonitrile (CAS 220227-59-8) is a chemical compound with the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. IUPAC name: 2-[2-fluoro-5-(trifluoromethyl)phenyl]acetonitrile. InChIKey: UTHSCSXLGDJQGQ-UHFFFAOYSA-N.
| Molecular formula | C9H5F4N |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-[2-fluoro-5-(trifluoromethyl)phenyl]acetonitrile |
| InChIKey | UTHSCSXLGDJQGQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)CC#N)F |
Computed by PubChem (NCBI)