Products 875306-79-9
CAS 875306-79-9 is the registry number for 6-Fluoro-5-(trifluoromethyl)-1h-indole, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 250mg, 1g, on request.
6-fluoro-5-(trifluoromethyl)-1H-indole (CAS 875306-79-9) is a chemical compound with the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. IUPAC name: 6-fluoro-5-(trifluoromethyl)-1H-indole. InChIKey: SAQOFVNWOKLANM-UHFFFAOYSA-N.
| Molecular formula | C9H5F4N |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 6-fluoro-5-(trifluoromethyl)-1H-indole |
| InChIKey | SAQOFVNWOKLANM-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)C(F)(F)F)F |
Computed by PubChem (NCBI)