CAS 1824048-48-7 appears in our catalog under these names: 2-Fluoro-4-methyl-3-(trifluoromethyl)benzonitrile, 95%, 2-Fluoro-4-methyl-3-(trifluoromethyl)benzonitrile, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
2-fluoro-4-methyl-3-(trifluoromethyl)benzonitrile (CAS 1824048-48-7) is a chemical compound with the molecular formula C9H5F4N and a molecular weight of 203.14 g/mol. IUPAC name: 2-fluoro-4-methyl-3-(trifluoromethyl)benzonitrile. InChIKey: DYBOBJDNRODHIR-UHFFFAOYSA-N.
| Molecular formula | C9H5F4N |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 2-fluoro-4-methyl-3-(trifluoromethyl)benzonitrile |
| InChIKey | DYBOBJDNRODHIR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C#N)F)C(F)(F)F |
Computed by PubChem (NCBI)