2，3-O-Isopropylidene-1-O-methyl-D-ribosic acid, 97%, 97%
cas: 54622-95-6 — see every product listed under this CAS number, including other names
2，3-O-Isopropylidene-1-O-methyl-D-ribosic acid, 97%, 97% (CAS 54622-95-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143YA-100mg |
| cas | 54622-95-6 |
| size | 100mg |
| availability | 50g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 10g | 1082.00 Pln | |
| Chemat | 25g | 2301.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid (CAS 54622-95-6) is a chemical compound with the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. IUPAC name: (3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid. InChIKey: BTFKDZSYIKUCGF-BYPJNBLXSA-N.
| Molecular formula | C9H14O6 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3aR,4R,6S,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carboxylic acid |
| InChIKey | BTFKDZSYIKUCGF-BYPJNBLXSA-N |
| SMILES | CC1(O[C@H]2[C@@H](O1)[C@@H](O[C@@H]2C(=O)O)OC)C |
Computed by PubChem (NCBI)