cas: 287175-08-0 — see every product listed under this CAS number, including other names
2,6-dichloro-3,5-dimethoxybenzaldehyde, 95%, 95% (CAS 287175-08-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FW1S-100mg |
| cas | 287175-08-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 626.00 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,6-dichloro-3,5-dimethoxybenzaldehyde (CAS 287175-08-0) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2,6-dichloro-3,5-dimethoxybenzaldehyde. InChIKey: VDBQFLMOULMNOE-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2,6-dichloro-3,5-dimethoxybenzaldehyde |
| InChIKey | VDBQFLMOULMNOE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)C=O)Cl)OC |
Computed by PubChem (NCBI)