CAS 1239783-16-4 is the registry number for Methyl 4,5-dichloro-2-methoxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
Methyl 4,5-dichloro-2-methoxybenzoate (CAS 1239783-16-4) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 4,5-dichloro-2-methoxybenzoate. InChIKey: JNYABXQGKADMCQ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 4,5-dichloro-2-methoxybenzoate |
| InChIKey | JNYABXQGKADMCQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(=O)OC)Cl)Cl |
Computed by PubChem (NCBI)