CAS 1247786-03-3 appears in our catalog under these names: Methyl 2-(2,3-dichlorophenyl)-2-hydroxyacetate, 95%, Methyl 2-(2,3-Dichlorophenyl)-2-hydroxyacetate. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 100mg.
Methyl 2-(2,3-dichlorophenyl)-2-hydroxyacetate (CAS 1247786-03-3) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: methyl 2-(2,3-dichlorophenyl)-2-hydroxyacetate. InChIKey: PWIYXISMBHIJAU-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | methyl 2-(2,3-dichlorophenyl)-2-hydroxyacetate |
| InChIKey | PWIYXISMBHIJAU-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C(=CC=C1)Cl)Cl)O |
Computed by PubChem (NCBI)