cas: 117976-47-3 — see every product listed under this CAS number, including other names
2-(((4-(3-Methoxypropoxy)-3-Methylpyridin-2-Yl)Methyl)Sulfonyl)-1H-Benzo[D]Imidazole, 98%, 98% (CAS 117976-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118QMB-100mg |
| cas | 117976-47-3 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 981.20 Pln | |
| Chemat | 5g | 3102.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole (CAS 117976-47-3) is a chemical compound with the molecular formula C18H21N3O4S and a molecular weight of 375.4 g/mol. IUPAC name: 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole. InChIKey: KNYNPBSPFHFPML-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole |
| InChIKey | KNYNPBSPFHFPML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)OCCCOC |
Computed by PubChem (NCBI)