cas: 117976-47-3 — see every product listed under this CAS number, including other names
2-[[[(4-Methoxypropoxy)-3-methyl-2-pyridinyl]methyl]sulfonyl]-1H-benzimidazole (CAS 117976-47-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Roth.
| brand | Roth |
|---|---|
| catalog number | ROTH-2YC4.3 |
| cas | 117976-47-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Roth | 25mg | 1345.09 Pln | |
| Roth | 50mg | 2430.60 Pln | |
| Roth | 100mg | 4573.30 Pln |
| delivery time | 2 week |
|---|
2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole (CAS 117976-47-3) is a chemical compound with the molecular formula C18H21N3O4S and a molecular weight of 375.4 g/mol. IUPAC name: 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole. InChIKey: KNYNPBSPFHFPML-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole |
| InChIKey | KNYNPBSPFHFPML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)OCCCOC |
Computed by PubChem (NCBI)