cas: 117976-47-3 — see every product listed under this CAS number, including other names
Rabeprazole sulfone 98% (CAS 117976-47-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633326-100mg |
| cas | 117976-47-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1093.50 Pln | |
| Ambeed | 5g | 3474.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A633326 |
2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole (CAS 117976-47-3) is a chemical compound with the molecular formula C18H21N3O4S and a molecular weight of 375.4 g/mol. IUPAC name: 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole. InChIKey: KNYNPBSPFHFPML-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O4S |
|---|---|
| Molecular weight | 375.4 g/mol |
| IUPAC name | 2-[[4-(3-methoxypropoxy)-3-methyl-2-pyridinyl]methylsulfonyl]-1H-benzimidazole |
| InChIKey | KNYNPBSPFHFPML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)OCCCOC |
Computed by PubChem (NCBI)