cas: 774192-30-2 — see every product listed under this CAS number, including other names
2-(({3-((2-chlorophenyl)methoxy)phenyl}methyl)amino)ethan-1-ol, 95% (CAS 774192-30-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1038629-10g |
| cas | 774192-30-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethanol (CAS 774192-30-2) is a chemical compound with the molecular formula C16H18ClNO2 and a molecular weight of 291.77 g/mol. IUPAC name: 2-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethanol. InChIKey: HLYKKFJNKCCMSE-UHFFFAOYSA-N.
| Molecular formula | C16H18ClNO2 |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | 2-[[3-[(2-chlorophenyl)methoxy]phenyl]methylamino]ethanol |
| InChIKey | HLYKKFJNKCCMSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)COC2=CC=CC(=C2)CNCCO)Cl |
Computed by PubChem (NCBI)