Products 332062-03-0
CAS 332062-03-0 is the registry number for (R)-3-Amino-4,4-diphenyl-butyric acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
(3S)-3-amino-4-(4-phenylphenyl)butanoic acid;hydrochloride (CAS 332062-03-0) is a chemical compound with the molecular formula C16H18ClNO2 and a molecular weight of 291.77 g/mol. IUPAC name: (3S)-3-amino-4-(4-phenylphenyl)butanoic acid;hydrochloride. InChIKey: OBYYHHGRCZYCAA-RSAXXLAASA-N.
| Molecular formula | C16H18ClNO2 |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | (3S)-3-amino-4-(4-phenylphenyl)butanoic acid;hydrochloride |
| InChIKey | OBYYHHGRCZYCAA-RSAXXLAASA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)