CAS 679796-43-1 appears in our catalog under these names: (S)-Alpha-(2-naphthalenylmethyl)-proline hydrochloride, 95%, (S)-a-(2-Naphthalenylmethyl)proline HCl, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-(naphthalen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride (CAS 679796-43-1) is a chemical compound with the molecular formula C16H18ClNO2 and a molecular weight of 291.77 g/mol. IUPAC name: (2S)-2-(naphthalen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: ADHGINNJMRTZOI-NTISSMGPSA-N.
| Molecular formula | C16H18ClNO2 |
|---|---|
| Molecular weight | 291.77 g/mol |
| IUPAC name | (2S)-2-(naphthalen-2-ylmethyl)pyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | ADHGINNJMRTZOI-NTISSMGPSA-N |
| SMILES | C1C[C@](NC1)(CC2=CC3=CC=CC=C3C=C2)C(=O)O.Cl |
Computed by PubChem (NCBI)