cas: 134724-87-1 — see every product listed under this CAS number, including other names
2-((1,3-Dioxoisoindolin-2-yl)oxy)acetic acid, 97%, 97% (CAS 134724-87-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DVW6-25mg |
| cas | 134724-87-1 |
| size | 25mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 501.20 Pln | |
| Chemat | 50mg | 587.60 Pln | |
| Chemat | 100mg | 693.20 Pln | |
| Chemat | 250mg | 1139.60 Pln | |
| Chemat | 1g | 2963.60 Pln | |
| Chemat | 5g | 10221.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(1,3-dioxoisoindol-2-yl)oxyacetic acid (CAS 134724-87-1) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)oxyacetic acid. InChIKey: STDDDVARCIVORC-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)oxyacetic acid |
| InChIKey | STDDDVARCIVORC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC(=O)O |
Computed by PubChem (NCBI)