cas: 134724-87-1 — see every product listed under this CAS number, including other names
2-Phthalimidehydroxy-acetic acid 97% (CAS 134724-87-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A282779-100mg |
| cas | 134724-87-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 820.94 Pln | |
| Ambeed | 250mg | 1343.81 Pln | |
| Ambeed | 1g | 3507.62 Pln | |
| Ambeed | 5g | 12090.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A282779 |
2-(1,3-dioxoisoindol-2-yl)oxyacetic acid (CAS 134724-87-1) is a chemical compound with the molecular formula C10H7NO5 and a molecular weight of 221.17 g/mol. IUPAC name: 2-(1,3-dioxoisoindol-2-yl)oxyacetic acid. InChIKey: STDDDVARCIVORC-UHFFFAOYSA-N.
| Molecular formula | C10H7NO5 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | 2-(1,3-dioxoisoindol-2-yl)oxyacetic acid |
| InChIKey | STDDDVARCIVORC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)OCC(=O)O |
Computed by PubChem (NCBI)